Empagliflozin Enantiomer Impurity
| Product Name | Empagliflozin Enantiomer Impurity |
|---|---|
| Alternate Names | Empagliflozin Impurities, Impurities of Empagliflozin |
| CAT No. | CS-O-14885 |
| CAS No. | Not Available |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 450.91 g/mol |
| Mol. For. | C₂₃H₂₇ClO₇ |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Empagliflozin |
| Purity | 95% |
| Therapeutic | Anti-Diabetic |
| Smileys | O[C@@H]1[C@@H](C2=CC=C(Cl)C(CC3=CC=C(O[C@@H]4COCC4)C=C3)=C2)O[C@@H](CO)[C@H](O)[C@H]1O |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Empagliflozin is a medication used in the treatment of type 2 diabetes mellitus. It works by inhibiting the sodium-glucose cotransporter-2 (SGLT2) in the kidneys, which leads to increased glucose excretion in urine and reduced blood glucose levels. However, Empagliflozin Enantiomer Impurity is an impurity that can be present in Empagliflozin.
Empagliflozin Enantiomer Impurity is a chemical compound that has the same chemical formula as Empagliflozin but has a different molecular structure. It is a chiral compound, which means it exists in two mirror-image forms. Empagliflozin Enantiomer Impurity is the mirror image of Empagliflozin and is considered an impurity because it has no therapeutic effect and can potentially cause harm.
The usage of Empagliflozin Enantiomer Impurity is strictly regulated, and it is only allowed in very small amounts in Empagliflozin medication. The standard limit for Empagliflozin Enantiomer Impurity in Empagliflozin medication is 0.15%. If the level of Empagliflozin Enantiomer Impurity is higher than the standard limit, it can cause adverse effects such as allergic reactions, gastrointestinal disturbances, and liver damage.
In conclusion, Empagliflozin Enantiomer Impurity is an impurity that can be present in Empagliflozin medication. Its usage is regulated due to its potential harmful effects, and its presence in Empagliflozin medication must be kept at a minimum level.
Get an Instant Quote
Related Compounds
Empagliflozin impurity A | Empagliflozin Acetyl impurity | Empagliflozin Impurity 62 | Empagliflozin Sulfonate Impurity | Empagliflozin Iodo R-furan impurity | Empagliflozin L- Glucono Diastereomer | Empagliflozin Impurity 2 | Empagliflozin R-Furanose | Empagliflozin Destetrahydrofuran Impurity | Empagliflozin Methyl Acetate | Empagliflozin Impurity 4 | Empagliflozin Intermediate-A | Empagliflozin Diol impurity (S-Isomer) | Empagliflozin Enantiomer Impurity | Empagliflozin Des bromomethoxy | Empagliflozin M464 | Empagliflozin alpha Isomer | Empagliflozin Impurity 40 | Empagliflozin Impurity 50 | Empagliflozin Impurity II | Empagliflozin Impurity 5 | Empagliflozin impurity D | Empagliflozin Impurity 46 | Empagliflozin Iodo impurity | O-Destetrahydrofuran O-Pentaacetyl Empagliflozin | Empagliflozin Impurity E | Empagliflozin Impurity 52 | Empagliflozin Methoxy impurity | Empagliflozin Recemic mixture | Empagliflozin Open Ring Impurity | Empagliflozin Impurity POE | Empagliflozin Methoxy Intermediate | Empagliflozin Bromo Impurity | Empagliflozin Nosyl ester hydroxy furan impurity | Hydroxy empagliflozin | DIMETHOXY EMPAGLIFLOZIN | Empagliflozin S-Furanose | Empagliflozin Impurity 82 | Empagliflozin Impurity 26 | Empagliflozin impurity C | Empagliflozin impurity B | Empagliflozin Dimer Impurity | Empagliflozin Nosyl impurity | Empagliflozin Sugar Dimer | Empagliflozin Silyl Impurity | Methoxy Empagliflozin R-Furanose | Empagliflozin M468 | Empagliflozin MonoAcetyl Impurity | Empagliflozin Dichloro impurity |