2-Fluoro-L-phenylalanine
| Product Name | 2-Fluoro-L-phenylalanine |
|---|---|
| Alternate Names | Phenylalanine Building Blocks, Building Blocks of Phenylalanine |
| CAT No. | CS-T-74400 |
| CAS No. | 19883-78-4 |
| Category | Building Blocks |
| Stock | Enquire |
| Mol. Wt. | Not Available |
| Mol. For. | Not Available |
| Hazardous | This is not a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Phenylalanine |
| Smileys | C1=CC=C(C(=C1)CC(C(=O)O)N)F |
| Canonical Smiles | C1=CC=C(C(=C1)CC(C(=O)O)N)F |
| InchIKey | NYCRCTMDYITATC-QMMMGPOBSA-N |
| Inchl | InChI=1S/C9H10FNO2/c10-7-4-2-1-3-6(7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| IUPAC | (2S)-2-amino-3-(2-fluorophenyl)propanoic acid |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Get an Instant Quote
Related Compounds
Boc-3-fluoro-D-phenylalanine | Boc-2-methyl-L-phenylalanine | Fmoc-3-nitro-D-phenylalanine | N-(Phenylacetyl)-L-Phenylalanine | N-(1-L-Phenylalanine)-4-(1-pyrene)butyramide | BOC-D-2-Fluorophenylalanine | Fmoc-2-(trifluoromethyl)-D-phenylalanine | L-Homophenylalanine | Fmoc-D-ß-phenylalanine | Fmoc-4-iodo-L-phenylalanine | Fmoc-4-chloro-D-phenylalanine | Fmoc-5-bromo-2-methoxy-L-phenylalanine | Boc-2-bromo-D-phenylalanine | Fmoc-ß-methyl-DL-phenylalanine | Boc-3-chloro-D-phenylalanine | Fmoc-3-chloro-L-phenylalanine | Fmoc-2-(trifluoromethyl)-L-phenylalanine | Fmoc-2-cyano-D-phenylalanine | Fmoc-3-iodo-L-phenylalanine | FMOC-D-4-Fluorophenylalanine | Fmoc-3-fluoro-L-phenylalanine | Fmoc-3-methyl-L-phenylalanine | Boc-2-bromo-L-phenylalanine | Boc-L-homophenylalanine | Alpha-methyl-l-4-fluorophenylalanine | Boc-D-ß-phenylalanine | Fmoc-l-4,4’-biphenylalanine | Boc-D-Phenylalanine methyl ester | Boc-3,4,5-trifluoro-L-phenylalanine | Fmoc-D-homophenylalanine | Boc-3-methyl-L-phenylalanine | BOC-D-4-Fluorophenylalanine | Fmoc-4-methyl-D-phenylalanine | Fmoc-4-chloro-L-phenylalanine | Fmoc-L-homophenylalanine | Boc-2-cyano-D-phenylalanine | Boc-3-cyano-L-phenylalanine | Boc-3,4-dichloro-D-phenylalanine | Fmoc-4-methyl-L-phenylalanine | Fmoc-3-cyano-L-phenylalanine | Fmoc-2-chloro-L-phenylalanine | Fmoc-2-bromo-L-phenylalanine | N-t-Boc-phenylalanine Cyclohexylamide | Fmoc-4-amino-D-phenylalanine | Boc-2-chloro-D-phenylalanine | Fmoc-4-bromo-D-phenylalanine | Fmoc-4-(Boc-amino)-D-phenylalanine | Fmoc-L-pentafluorophenylalanine | Boc-3-cyano-D-phenylalanine | Boc-D-homophenylalanine | Fmoc-4-(Boc-amino)-L-phenylalanine | Boc-2-nitro-D-phenylalanine | Fmoc-4-diethylphosphomethyl-d-phenylalanine | Fmoc-2-bromo-D-phenylalanine | Fmoc-3-iodo-D-phenylalanine | Fmoc-2-methyl-D-phenylalanine | Boc-4-nitro-D-phenylalanine | Boc-3,4,5-trifluoro-D-phenylalanine | Fmoc-2-cyano-L-phenylalanine | Fmoc-3-chloro-D-phenylalanine | Boc-4-acetyl-l-phenylalanine | Fmoc-4-(Boc-aminomethyl)-L-phenylalanine | Fmoc-2-chloro-D-phenylalanine | Boc-a-methyl-D-phenylalanine | Fmoc-4-amino-L-phenylalanine | Fmoc-4-bromo-L-phenylalanine | Fmoc-3-nitro-L-phenylalanine | Fmoc-3-bromo-D-phenylalanine | Fmoc-4-(phosphonomethyl)-phenylalanine | Fmoc-3-cyano-D-phenylalanine |