3,4-Dimethoxyphenylalanine
| Product Name | 3,4-Dimethoxyphenylalanine |
|---|---|
| Alternate Names | Phenylalanine Intermediates, Intermediates of Phenylalanine |
| CAT No. | CS-O-33506 |
| CAS No. | 55-59-4 |
| Category | Intermediates |
| Stock | Enquire |
| Mol. Wt. | 225.24 g/mol |
| Mol. For. | C11H15NO4 |
| Hazardous | This is not a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Phenylalanine |
| Therapeutic | Anti-Parkinsons |
| Smileys | COC1=C(OC)C=CC(CC(N)C(O)=O)=C1 |
| Canonical Smiles | COC1=C(C=C(C=C1)CC(C(=O)O)N)OC |
| InchIKey | VWTFNYVAFGYEKI-UHFFFAOYSA-N |
| Inchl | InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14) |
| IUPAC | 2-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Get an Instant Quote
Related Compounds
L-4-Benzoylphenylalanine | N-Acetyl-D-phenylalanine | Boc-d-4-carbamoylphenylalanine | N-Acetyl-3-iodo-4-(4-methoxyphenoxy)-L-phenylalanine Amide | Fmoc-2-iodo-D-phenylalanine | N-Boc-erythro-ß-methylphenylalanine | N-(trans-4-tert-Butyl-cyclohexyl)carbonyl-D-phenylalanine | N-(Carbobenzyloxy)-L-phenylalanine | D-Phenylalanine 4-Nitroanilide | N-Boc-4-phenyl-L-phenylalanine | L-p-Nitro(2,3,5,6-2H4)phenylalanine | Boc-4-iodo-L-phenylalanine | Boc-L-pentafluorophenylalanine | Boc-4-methyl-D-phenylalanine | Boc-4-cyano-L-phenylalanine | N-(2-Pyrazinylcarbonyl)-D-phenylalanine | Boc-4-amino-D-phenylalanine | L-2-Cyanophenylalanine | L-Phenylalanine Benzyl Ester Hydrochloride | D-4-Cyanophenylalanine | N-Phthalimido 4-Nitro-L-phenylalanine | Boc-a-methyl-3-methoxy-DL-phenylalanine | L-4,4'-Biphenylalanine | Alpha-Methyl-DL-phenylalanine methyl ester, HCl | D-3-Chlorophenylalanine | Boc-4-azido-L-phenylalanine | Boc-4-chloro-L-phenylalanine | N-Methylphenylalanine | Boc-3-nitro-L-phenylalanine | DL-Phenylalanine Methyl Ester | D-(R)-Homophenylalanine Hydrochloride | alfa-Methyl-L-phenylalanine methyl ester HCl | Boc-D-3,5-difluorophenylalanine | L-?Phenylalanine 4-?Nitroanilide | N-Glutaryl-L-phenylalanine p-nitroanilide | L-Phenylalanyl-L-phenylalanine Methyl Ester Hydrochloride | N-Acetyl-α-cyano-p-benzoyl-D,L-phenylalanine Ethyl Ester | N-Boc-4-nitro-L-phenylalanine t-Butyl Ester | Boc-4-(Fmoc-aminomethyl)-D-phenylalanine | P-Amino-DL-phenylalanine | L-Homophenylalanine ethyl ester hydrochloride | Boc-alpha-methyl-D-4-fluorophenylalanine | L-4-Acetylphenylalanine | Boc-d-pentafluorophenylalanine | D-2,4-Dichlorophenylalanine | D-2-Bromophenylalanine | Boc-4-(Fmoc-aminomethyl)-L-phenylalanine | Acetyl-DL-phenylalanine ß-Naphthyl Ester | DL-4-Methylphenylalanine | O-Methyl-D-phenylalanine | Cbz-DL-ß-phenylalanine | Boc-2-methyl-d-beta-phenylalanine | BOC-DL-3,3-diphenylalanine | DL-Phenylalanine methyl ester hydrochloride | N-Benzoyl-L-phenylalanine | D-2-Cyanophenylalanine | L-Homophenylalanine Methyl Ester | D-Homophenylalanine Ethyl Ester Hydrochloride | N-Acetylphenylalanine | Boc-l-2-fluorophenylalanine | Boc-L-4-fluorophenylalanine | Boc-D-Phenylalanine | Boc-4-methoxy-dl-phenylalanine dicyclohexylammonium salt | p-Amino-L-phenylalanine Hydrochloride | Boc-4-(trifluoromethyl)-D-phenylalanine | N-Dansyl-L-phenylalanine | Boc-4-bromo-D-phenylalanine | BOC-D-3,4-Difluorophenylalanine | Boc-4-iodo-D-phenylalanine | Boc-2-cyano-L-phenylalanine |