9-Oxofolic Acid
| Product Name | 9-Oxofolic Acid |
|---|---|
| Alternate Names | Folic Acid Impurities, Impurities of Folic Acid |
| CAT No. | CS-T-38286 |
| CAS No. | 39707-61-4 |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 455.38 g/mol |
| Mol. For. | C₁₉H₁₇N₇O₇ |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Folic Acid |
| Purity | 95% |
| Smileys | O=C(O)C(NC(C1=CC=C(NC(C2=NC3=C(N=C2)N=C(N)NC3=O)=O)C=C1)=O)CCC(O)=O |
| Canonical Smiles | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NC(=O)C2=CN=C3C(=N2)C(=O)NC(=N3)N |
| InchIKey | HOYWIHISJSBZLW-UHFFFAOYSA-N |
| Inchl | InChI=1S/C19H17N7O7/c20-19-25-14-13(17(31)26-19)23-11(7-21-14)16(30)22-9-3-1-8(2-4-9)15(29)24-10(18(32)33)5-6-12(27)28/h1-4,7,10H,5-6H2,(H,22,30)(H,24,29)(H,27,28)(H,32,33)(H3,20,21,25,26,31) |
| IUPAC | 2-[[4-[(2-amino-4-oxo-3H-pteridine-6-carbonyl)amino]benzoyl]amino]pentanedioic acid |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
9-Oxofolic acid, also known as 10-formyl folic acid, is a derivative of folic acid, a B-vitamin essential for various biological processes in the body, including DNA synthesis, cell division, and protein metabolism. 9-Oxofolic acid is an intermediate in the formation of tetrahydrofolic acid, the active form of folic acid, and plays a crucial role in the folate metabolic pathway.
In terms of usage, 9-Oxofolic acid is commonly used as a starting material for the synthesis of various folic acid derivatives, including methotrexate, an anticancer drug that inhibits the enzyme dihydrofolate reductase. It is also used in the production of diagnostic agents for medical imaging, such as radiopharmaceuticals for positron emission tomography (PET) scans.
Chemically, 9-Oxofolic acid is a yellowish-orange crystalline powder that is soluble in water and ethanol. Its molecular formula is C20H18N7O6 and its molecular weight is 454.4 g/mol. It has a pKa value of 3.3 and a melting point of 247-249 °C.
In conclusion, while 9-Oxofolic acid may not be commonly known or used, it plays a significant role in the synthesis of various folic acid derivatives and medical imaging agents. Its chemical properties and functions contribute to the understanding and development of treatments for cancer and other medical conditions.
Get an Instant Quote
Related Compounds
Cis 2-(1,6-dimethylpiperidine-3-yl)propan-2-ol | Folic Acid NHS Ester (~90% ) | Folic acid Impurity 3 | N10-Nitroso folic acid | Folic acid Impurity 8 | Folic acid Impurity 4 | Folic acid impurity G | Folic Acid EP Impurity E | Folic Acid EP Impurity F | Ferrous Sulphate & Folic acid pellets | trans 2-(1,6-Dimethylpiperidin-3-yl)propan-2-ol | Folic acid impurity D | Isofolic acid | Calcium-D-5-Methyltetrahydrofolic acid | Folic Acid Impurity B | Folic Acid Impurity B | Tetrahydrofolic Acid | Dimethyltetrahydrofolic acid (DiMeTHFA) | Folic acid impurity H | N-Nitroso 2-Deamino-2-hydroxyfolic acid | D-Folic Acid | Folic acid Impurity A | N-Nitrosofolic acid |