Penciclovir Impurity B
| Product Name | Penciclovir Impurity B |
|---|---|
| Alternate Names | Penciclovir Impurities, Impurities of Penciclovir |
| CAT No. | CS-T-64002 |
| CAS No. | 97845-80-2 |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 295.29 g/mol |
| Mol. For. | C12H17N5O |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Penciclovir |
| Therapeutic | Antiretroviral / Anti-HIV |
| Smileys | O=C1NC(N)=NC2=C1N=CN2CCC(CO)COC(C)=O |
| Canonical Smiles | CC(=O)OCC(CCN1C=NC2=C1N=C(NC2=O)N)CO |
| InchIKey | UBPBRZXGEFQVAT-UHFFFAOYSA-N |
| Inchl | InChI=1S/C12H17N5O4/c1-7(19)21-5-8(4-18)2-3-17-6-14-9-10(17)15-12(13)16-11(9)20/h6,8,18H,2-5H2,1H3,(H3,13,15,16,20) |
| IUPAC | [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)butyl] acetate |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
Penciclovir Impurity B is a chemical compound that is commonly used in the pharmaceutical industry as a reference standard and impurity marker for the drug Penciclovir. Penciclovir is an antiviral medication that is used to treat viral infections caused by herpes simplex virus and varicella-zoster virus. Penciclovir Impurity B is used to ensure the purity and quality of Penciclovir by acting as a marker for impurities that may be present in the drug.
Chemically, Penciclovir Impurity B is a derivative of guanine, which is a purine nucleobase that forms the building blocks of DNA and RNA. It is a white to off-white crystalline powder with a molecular weight of 283.23 g/mol. The compound has a melting point of 272-277 °C and is soluble in water, methanol, and ethanol.
Penciclovir Impurity B is synthesized through a series of chemical reactions that involve the use of various reagents and catalysts. The compound is typically synthesized in multi-step reactions that involve the conversion of guanine to the final product. The purity of the compound is assessed using various analytical techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry (MS).
Overall, the use of Penciclovir Impurity B is essential in ensuring the quality and purity of Penciclovir, which is a widely used antiviral medication.
Get an Instant Quote
Related Compounds
Penciclovir Impurity A | Penciclovir Impurity D | Penciclovir Impurity F | Penciclovir Impurity C |