9-Methoxymethyl Guanine
| Product Name | 9-Methoxymethyl Guanine |
|---|---|
| Alternate Names | Guanine Impurities, Impurities of Guanine |
| CAT No. | CS-T-32526 |
| CAS No. | 1202645-50-8 |
| Category | Impurities |
| Stock | IN-Stock |
| Mol. Wt. | 195.18 g/mol |
| Mol. For. | C₇H₉N₅O₂ |
| Hazardous | This is a Hazardous Compound |
| COA | View Sample COA |
| MSDS | View Sample MSDS |
| Parent API | Guanine |
| Purity | 95% |
| Smileys | NC(N1)=NC(N(COC)C=N2)=C2C1=O |
| Canonical Smiles | COCN1C=NC2=C1N=C(NC2=O)N |
| InchIKey | WVWIFQBDNZCHIY-UHFFFAOYSA-N |
| Inchl | InChI=1S/C7H9N5O2/c1-14-3-12-2-9-4-5(12)10-7(8)11-6(4)13/h2H,3H2,1H3,(H3,8,10,11,13) |
| IUPAC | 2-amino-9-(methoxymethyl)-1H-purin-6-one |
| Controlled | No |
| Shipping | Free for purchase above 1000$ |
| Delivery | In-Stock, products will be dispatched within 24 hours via FedEx for USA, Europe, and other countries. |
| Return | Returns/replacement accepted if you are not satisfied with the quality of the product, (please send us an email with the reason/issues which are facing, within 15 days, after receipt of the product). |
| Ordering | Place your order online or by email sales@clearsynth.com |
9-Methoxymethyl Guanine is a chemical compound used in the development of antiviral drugs. It is a purine derivative, specifically a guanine analog, that has a methoxymethyl group attached to the 9 position of the purine ring. This modification allows the compound to selectively inhibit viral DNA polymerase, preventing the replication of viral DNA and thereby inhibiting the spread of viral infections.
9-Methoxymethyl Guanine is a potent and selective inhibitor of viral DNA polymerase, making it an important tool in the development of antiviral drugs. It has been used in the development of drugs to treat herpes simplex virus (HSV) and varicella zoster virus (VZV) infections. In addition, it has also been studied for its potential use in the treatment of viral infections such as hepatitis B and C.
The chemical structure of 9-Methoxymethyl Guanine is important in its function as an antiviral compound. The methoxymethyl group at the 9 position of the purine ring allows the compound to mimic the structure of guanine, which is a constituent of viral DNA. This allows the compound to be incorporated into the viral DNA during replication, which in turn inhibits further replication of the virus.
In summary, 9-Methoxymethyl Guanine is an important compound in the development of antiviral drugs. Its ability to selectively inhibit viral DNA polymerase makes it a potent tool in the fight against viral infections. Its chemical structure and function provide valuable insights into the development of new antiviral compounds.
Get an Instant Quote
Related Compounds
N1-(Pivaloyloxy)methyl-N2-(dimethylamino)methylene 9-Deazaguanine |