COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
"(1-Oxyl-2,2,5,5-tetramethyl-3-pyrroline-3-methyl) Methaneth... | Stable Isotopes | CS-T-60076 | 384342-58-9 | Enquire |
"(1-Oxyl-2,2,5,5-tetramethyl-3-pyrroline-3-methyl) Methaneth... | Stable Isotopes | CS-T-60075 | 384342-57-8 | Enquire |
"1,1-Dichloroethane D4" | Stable Isotopes | CS-T-52595 | 40202-09-3 | Enquire |
"1,1'-Thiobismethane D3" | Stable Isotopes | CS-T-62011 | 926-09-0 | Enquire |
"1,2-Bis(2,4,6-tribromophenoxy)ethane-d4" | Stable Isotopes | CS-T-68655 | 1794620-64-6 | Enquire |
"1,2-Dibromoethane 13C2" | Stable Isotopes | CS-T-52518 | 33458-49-0 | Enquire |
"1,2-Dimethoxyethane-d4" | Stable Isotopes | CS-T-89335 | 143585-58-4 | Enquire |
"2-(4,6-Diamino-1,3,5-triazin-2-yl)sulfanylethanesulfonic Ac... | Stable Isotopes | CS-T-88234 | 1794737-32-8 | Enquire |
"2,5-Dihydro-2-hydroxy-5-nitro-2-furanmethanediol-d3 Triacet... | Stable Isotopes | CS-T-91725 | 1346604-22-5 | Enquire |
"2-Hydroxyethyl-1,1,2,2-d4 Methanethiosulfonate" | Stable Isotopes | CS-T-56036 | 1020719-50-9 | Enquire |
"Aminoiminomethanesulfonic Acid 15N2,13C" | Stable Isotopes | CS-T-47875 | 1246820-44-9 | Enquire |
"Bis(1,3-dithian-2-yl)methane-d2" | Stable Isotopes | CS-T-49301 | 105479-87-6 | Enquire |
"Diiodomethane-13C,d2" | Stable Isotopes | CS-T-90272 | 1217038-24-8 | Enquire |
(1-Oxyl-2,2,5,5-tetraethyl-∆3-pyrroline-3-methyl) Methanethi... | Stable Isotopes | CS-T-99399 | Not Available | Enquire |
(1-Oxyl-2,2,5,5-tetraethyl-∆3-pyrroline-3-methyl) Methanethi... | Stable Isotopes | CS-T-99400 | Not Available | Enquire |
(1-Oxyl-2,2,5,5-tetraethyl-∆3-pyrroline-3-methyl) Methanethi... | Stable Isotopes | CS-T-99401 | Not Available | Enquire |
(1-Oxyl-2,2,5,5-tetramethyl-Δ3-pyrroline-3-methyl) Methaneth... | Stable Isotopes | CS-T-84379 | 1404308-02-6 | Enquire |
(5a)-Pregnane-3,20-dione-d4 Cyclic 20-(1,2-Ethanediyl Acetal... | Stable Isotopes | CS-T-102856 | 1452-23-9(Unlabelled) | Enquire |
(S,E)-1-(3-(2-(7-Chloroquinolin-2-yl)vinyl)phenyl)-3-(2-(2-h... | Stable Isotopes | CS-T-100626 | Not Available | Enquire |
(Z)-α-[(Triphenylmethoxy)imino]-2-[(triphenylmethyl)amino]-4... | Stable Isotopes | CS-T-97124 | Not Available | Enquire |
[3,4-Bis(benzyloxy)phenyl]-1,2-ethanediol-d5 | Stable Isotopes | CS-T-101819 | 1794960-44-3 | Enquire |
[U-Ring-13C6]-4-Chlorophenyl trifluoromethanesulfonate | Stable Isotopes | CS-EK-02043 | 29540-84-9 unlabeled | Enquire |
1,1,1-Trichloroethane D3 | Stable Isotopes | CS-BE-00060 | 2747-58-2 | Enquire |
1,1,1-Trifluoromethanesulfonic Acid 2-(2-Propen-1-yl)phenyl ... | Stable Isotopes | CS-T-102008 | Not Available | Enquire |
1,1,2,2-Tetrachloroethane-D2 | Stable Isotopes | CS-CE-00858 | 33685-54-0 | Enquire |
1,1,2-Trichloroethane-d3 | Stable Isotopes | CS-C-00773 | 171086-93-4 | Enquire |
1,1-Dichloro-2,2-bis(4-chlorophenyl-d4)ethane | Stable Isotopes | CS-C-01202 | 93952-20-6 | Enquire |
1,2-Bis[2-(4-Dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazinyl)... | Stable Isotopes | CS-T-99355 | Not Available | Enquire |
1,2-Dimethoxyethane D10 | Stable Isotopes | CS-BX-00278 | 107975-86-0 | Enquire |
1,2-Ethanedithiol D4 | Stable Isotopes | CS-BE-00037 | 540-63-6 (Unlabeled) | Enquire |
1,3-Adamantanedi[(ethyl-d2) methanesulfonate] | Stable Isotopes | CS-T-94746 | Not Available | Enquire |
17β-Hydroxy-17-ethyl-estra-5(10),9(11)-dien-3-one Cyclic 1,2... | Stable Isotopes | CS-T-101324 | Not Available | Enquire |
1-Acetyl-2,2,5,5-tetramethyl-∆3-(pyrroline-15N)-3-methyl Met... | Stable Isotopes | CS-T-65242 | 1287068-01-2 | Enquire |
1-Oxyl-2,2,5,5-tetramethyl-∆3-(methanesulfonyloxymethyl)pyrr... | Stable Isotopes | CS-T-103134 | Not Available | Enquire |
2-(1,3,5-Trimethyl-1H-pyrazol-4-yl)ethyl methanesulfonate 13... | Stable Isotopes | CS-EK-00151 | 1189155-65-4 unlabeled | Enquire |
2-(4-Amino-1,3,5-triazin-2-yl)sulfanylethanesulfonic Acid-d4 | Stable Isotopes | CS-T-99381 | 1794793-34-2 | Enquire |
2,2,2-Trichloro-1,1-ethanediol-1,1-d2 | Stable Isotopes | CS-O-37932 | 19220-07-6 | Enquire |
2,2'-[Carbonylbis(thio)]bisethanesulfonic Acid-d8 Disodium S... | Stable Isotopes | CS-T-99339 | Not Available | Enquire |
2,2-Bis(4-hydroxyphenyl)-1,1,1-trichloroethane-d8 (Major) | Stable Isotopes | CS-T-101810 | 1794780-53-2 | Enquire |
2,2'-Bis(hydroxyphenyl)methane-d10 (d9 Major) | Stable Isotopes | CS-T-101813 | Not Available | Enquire |
2,2-Dimethyl-1,3-dioxolane-4-methanol 4-Methanesulfonate-d5 | Stable Isotopes | CS-T-99278 | 1346604-82-7 | Enquire |
2,4'-Dichlorodiphenyltrichloroethane D8 | Stable Isotopes | CS-T-52593 | 221899-88-3 | In Stock |
2-[[(Guanidino)(imino)methyl]sulfanyl]ethanesulfonic Acid-d4 | Stable Isotopes | CS-T-79267 | 1794941-90-4 | Enquire |
2-Hydroxyphenylacetic Acid-d4 Trifluoromethanesulfonate | Stable Isotopes | CS-T-101280 | Not Available | Enquire |
2-Methoxy-5-methyl-γ-phenylbenzenepropanol Methanesulfonate-... | Stable Isotopes | CS-T-99172 | Not Available | Enquire |
3',5'-Dimethanesulfonate Thymidine, Methyl-d3 | Stable Isotopes | CS-T-99282 | Not Available | Enquire |
4-[[4-[(Aminoiminomethyl)amino]benzoyl]oxy]-benzeneacetic Ac... | Stable Isotopes | CS-SN-00011 | 71079-09-9(Unlabelled) | Enquire |
4-[4-(Methanesulfonyloxy)-1-butynyl]-a,a-di(methyl-d3)benzen... | Stable Isotopes | CS-T-57592 | 1020719-58-7 | Enquire |
a,4-Dihydroxy-3-methoxy-a-methyl-benzeneethanesulfonic Acid ... | Stable Isotopes | CS-T-90645 | 1794789-29-9 | Enquire |
Benz[a]anthracene-7-chloromethane-13C | Stable Isotopes | CS-T-98280 | 1391054-60-6 | Enquire |
Benzo[d]isoxazol-3-yl-methanesulfonyl-d4 Chloride | Stable Isotopes | CS-T-48685 | 1189428-60-1 | Enquire |
Bethanechol-d9 | Stable Isotopes | CS-T-101828 | Not Available | Enquire |
Bis(tosyloxy)methane-D₂ | Stable Isotopes | CS-T-103150 | 1454889-26-9 | Enquire |
Bromochloromethane D2 | Stable Isotopes | CS-T-49658 | 3149-74-4 | Enquire |
Bromodichloromethane-13C | Stable Isotopes | CS-T-08146 | 93952-10-4 | Enquire |
Bromoethane-1,1,2,2-d4 | Stable Isotopes | CS-C-00157 | 25854-32-4 | Enquire |
Bromoethane-1,1-d2 | Stable Isotopes | CS-C-00114 | 3652-84-4 | Enquire |
Bromoethane-2-d1 | Stable Isotopes | CS-C-00151 | 23705-67-1 | Enquire |
Bromomethane 13C | Stable Isotopes | CS-BE-00063 | 51624-21-6 | Enquire |
Chloroethane-2,2,2-d3 (gas) | Stable Isotopes | CS-C-01134 | 7371-46-2 | Enquire |
Chloroiodomethane-d2 (stabilized with copper) | Stable Isotopes | CS-C-00949 | 129933-14-8 | Enquire |
Dibromochloromethane 13C | Stable Isotopes | CS-T-52512 | 93951-99-6 | Enquire |
Dichloromethane Dry | Stable Isotopes | CS-O-45873-2.5L | 75-09-2 | Enquire |
Dichloromethane Dry | Stable Isotopes | CS-O-45873 | 75-09-2 | Enquire |
Dichloromethane-13C | Stable Isotopes | CS-T-90937 | 70110-03-1 | Enquire |
Dichloronitromethane | Stable Isotopes | CS-T-52644 | 7119-89-3 | Enquire |
Difluoromethane 13C D2 | Stable Isotopes | CS-BE-00062 | 27572-46-9 | Enquire |
Dimethachlor Ethane Sulfonic Acid Sodium Salt-d6 | Stable Isotopes | CS-T-96244 | Not Available | Enquire |
Ethane 1-13C | Stable Isotopes | CS-BE-00066 | 6145-17-1 | Enquire |
Ethane-D5-Thiol | Stable Isotopes | CS-O-16339 | 61260-03-5 | Enquire |
Ethanediimidic Acid 1,2-Dihydrazide-15N4 | Stable Isotopes | CS-T-100342 | Not Available | Enquire |
Eugenol-d3 Methanesulfonate | Stable Isotopes | CS-T-102819 | 91971-63-0(Unlabelled) | Enquire |
Hexachloroethane-13C1 | Stable Isotopes | CS-C-00639 | 93952-15-9 | Enquire |
Iodomethane-d2 | Stable Isotopes | CS-ZG-28042 | 865-43-0 | Enquire |
Methane 13C D4 | Stable Isotopes | CS-BE-00061 | 2644-20-4 | Enquire |
Methane-13C-sulfonate Sodium (contains up to 15% inorganics) | Stable Isotopes | CS-T-101151 | Not Available | Enquire |
Methane-13C-sulfonyl Chloride | Stable Isotopes | CS-T-99713 | 1173023-34-1 | Enquire |
Methane-d3-sulfinic Acid Sodium Salt | Stable Isotopes | CS-T-95012 | 2129597-38-0 | Enquire |
METHANESULFONIC ACID D4 | Stable Isotopes | CS-R-00469 | 203578-15-8 | Enquire |
Methanesulfonyl Chloride-d3,13C | Stable Isotopes | CS-T-57581 | 1216581-01-9 | Enquire |
Methanethiol - D3 | Stable Isotopes | CS-O-36418 | 7175-74-8 | Enquire |
Methyl Methanethiosulfonate 13C | Stable Isotopes | CS-T-58405 | 1309943-60-9 | Enquire |
Methyl Methanethiosulfonate-d3 | Stable Isotopes | CS-T-58406 | 55800-37-8 | Enquire |
N-(2-(2-(2-Methoxy-d3-4-morpholinophenylamino)-5-fluoropyrim... | Stable Isotopes | CS-T-100068 | Not Available | Enquire |
N-(4-(4-Fluorophenyl)-5-formyl-6-isopropylpyrimidin-2-yl)-N-... | Stable Isotopes | CS-T-75580 | 1216862-95-1 | Enquire |
N-(5-Chloropyridin-2-yl)-N'-[(1S,2S,4R)-4-[(dimethylamino)ca... | Stable Isotopes | CS-T-100628 | Not Available | Enquire |
N,N'-(Ethane-d4-1,2-diyl)bis(2-(2,6-dimethylphenoxy)acetamid... | Stable Isotopes | CS-T-101418 | Not Available | Enquire |
N,N-Dimethylethanediamine-d6 | Stable Isotopes | CS-T-53539 | 854484-96-1 | Enquire |
N,N-Dimethylethanediamine-d6 Dihydrochloride | Stable Isotopes | CS-T-103015 | 3984-76-7(Unlabelled) | In Stock |
N-[4-(4-Fluorophenyl)-5-hydroxymethyl-6-isopropylpyrimidin-2... | Stable Isotopes | CS-T-99233 | Not Available | Enquire |
N-[4-(4-Fluorophenyl)-5-methyl-6-(1-methylethyl)-2-pyrimidin... | Stable Isotopes | CS-T-76721 | 1794941-65-3 | Enquire |
N-Cyanoacetylurethane-13C3,15N2 | Stable Isotopes | CS-T-102490 | 6629-04-5(Unlabelled) | Enquire |
Nitroethane-d5 | Stable Isotopes | CS-C-01062 | 57817-88-6 | Enquire |
Sodium Benzoylthioethanesulfonate D4 | Stable Isotopes | CS-T-61337 | 1189657-00-8 | Enquire |
Sodium Bromoethanesulfonate D4 | Stable Isotopes | CS-T-61341 | 1189914-19-9 | Enquire |
Tetracyanoquinodimethane-13C2 | Stable Isotopes | CS-T-99814 | Not Available | Enquire |
Tetracyanoquinodimethane-13C4 | Stable Isotopes | CS-T-99813 | Not Available | Enquire |
Trifluoromethane-d (gas) | Stable Isotopes | CS-C-01452 | 558-22-5 (Unlabelled) | Enquire |
Urethane D5 | Stable Isotopes | CS-T-62645 | 73962-07-9 | Enquire |
Urethane-13C,15N | Stable Isotopes | CS-T-102929 | 51-79-6(Unlabelled) | Enquire |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
"N-(3-Chlorobenzyl)ethane-1,2-diamine" | API Standards | CS-M-45432 | 102450-75-9 | Enquire |
(S)-Bethanechol | API Standards | CS-T-06419 | 944538-50-5 | Enquire |
2,2,2-Trifluoroethyl trichloromethane-sulfonate | API Standards | CS-M-01569 | 23199-56-6 | Enquire |
Bamethane hemisulfate salt | API Standards | CS-T-48550 | 5716-20-1 | In Stock |
bis((1,1,1,3,3,3-hexafluoropropan-2-yl)oxy)methane | API Standards | CS-O-44361 | 194039-81-1 | Enquire |
ethenyldiphenylsulfanium trifluoromethanesulfonate | API Standards | CS-EM-02544 | 247129-88-0 | Enquire |
Fluoroiodomethane | API Standards | CS-T-54843 | 373-53-5 | Enquire |
Phenylmethanesulfonyl-acetic acid | API Standards | CS-M-10102 | 28203-59-0 | Enquire |
Safinamide Methanesulfonate | API Standards | CS-DG-00001 | 202825-46-5 | In Stock |
Tetraethoxymethane | API Standards | CS-T-43587 | 78-09-1 | Enquire |
Tetramethoxymethane | API Standards | CS-T-61927 | 1850-14-2 | Enquire |
Tetrapropylmethane | API Standards | CS-T-86847 | 17312-72-0 | Enquire |
Trifluoromethanesulfonyl fluoride | API Standards | CS-M-01917 | 335-05-7 | Enquire |
Triiodomethane | API Standards | CS-T-45487 | 75-47-8 | Enquire |
Triphenylmethane | API Standards | CS-CE-00267 | 519-73-3 | In Stock |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
1-[4-(4-Hydroxybenzyl)phenoxy]-2-diethylaminoethane hydrochl... | Metabolites | CS-O-43434 | 116505-58-9 | Enquire |
1-[4-Benzylphenoxy]-2-ethylaminoethane hydrochloride | Metabolites | CS-O-43435 | 1052514-21-2 | Enquire |
19-Norcholest-5(10)-ene-6-methanol, 3-(2,2-dimethyl-1-oxopro... | Metabolites | CS-O-43785 | 2413968-59-7 | Enquire |
2,2'-(ethane-1,2-diylbis(azanediyl))dibutanal | Metabolites | CS-O-35630 | 502-25-0 | Enquire |
Aminomethanephosphonic Acid | Metabolites | CS-T-03041 | 1066-51-9 | In Stock |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
Butyl methanesulfonate (Y0001304) | EP Standards | CS-EG-00229 | 1912-32-9 | Enquire |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
"1,1,1-Tris(diphenylphosphino)methane" | Fine Chemicals | CS-DC-00575 | 28926-65-0 | Enquire |
"1,1-Diphenyldiazomethane" | Fine Chemicals | CS-T-88274 | 883-40-9 | Enquire |
"1,2-Bis(di-2-pyridylphosphino)ethane" | Fine Chemicals | CS-DC-00484 | 106308-26-3 | Enquire |
(3-Methoxyphenyl)methanethiol | Fine Chemicals | CS-ED-02173 | 7166-64-5 | Enquire |
(4-Acetylphenyl)phenylmethane | Fine Chemicals | CS-M-02608 | 782-92-3 | Enquire |
(Diphenylphosphino)methanethiol | Fine Chemicals | CS-T-20949 | 324753-16-4 | Enquire |
(Trimethylsilyl)diazomethane | Fine Chemicals | CS-DA-00608 | 18107-18-1 | Enquire |
1,1,1-Trichloroethane | Fine Chemicals | CS-O-14593 | 71-55-6 | Enquire |
1,1,1-trifluoro-2-chloroethane | Fine Chemicals | CS-ED-01023 | 75-88-7 | Enquire |
1,1,1-Tris(hydroxymethyl)ethane | Fine Chemicals | CS-DB-00143 | 77-85-0 | Enquire |
1,1,2,2-Tetrachloroethane | Fine Chemicals | CS-DB-00133 | 79-34-5 | In Stock |
1,1-Dibutoxyethane | Fine Chemicals | CS-O-59003 | 871-22-7 | Enquire |
1,2-Bis(2-cyanoethoxy)ethane | Fine Chemicals | CS-ZG-97424 | 3386-87-6 | Enquire |
1,2-Bis-(4-methyl-piperazin-1-yl)-ethane | Fine Chemicals | CS-ZI-35651 | 77267-14-2 | Enquire |
1,2-Bis(Chloromethoxy)Ethane | Fine Chemicals | CS-T-11873 | 13483-18-6 | Enquire |
1,2-Bis(diethylphosphino)ethane | Fine Chemicals | CS-DC-00454 | 6411-21-8 | Enquire |
1,2-Bis(phenylsulfinyl)ethane | Fine Chemicals | CS-DC-00414 | 6099-21-4 | Enquire |
1,2-Bis(phenylsulfonyl)ethane | Fine Chemicals | CS-O-41776 | 599-94-0 | Enquire |
1,2-Bis(trichlorosilyl)ethane | Fine Chemicals | CS-DA-00477 | 2504-64-5 | Enquire |
1,2-Bis(trimethylsilyloxy)ethane | Fine Chemicals | CS-DA-00055 | 7381-30-8 | Enquire |
1,2-Dibromo-1-chloroethane | Fine Chemicals | CS-O-56472 | 598-20-9 | Enquire |
1,2-Diethoxyethane | Fine Chemicals | CS-T-73654 | 629-14-1 | Enquire |
1,2-Difluoroethane | Fine Chemicals | CS-M-02322 | 624-72-6 | Enquire |
1,2-Ethanediamine, phosphate | Fine Chemicals | CS-ED-01480 | 14852-17-6 | Enquire |
1,2-Ethanedithiol | Fine Chemicals | CS-T-22218 | 540-63-6 | Enquire |
1-Bromo-2-chloroethane | Fine Chemicals | CS-X-00001 | 107-04-0 | In Stock |
1-Fluoro-2-iodoethane | Fine Chemicals | CS-M-00701 | 762-51-6 | Enquire |
2-((tert-Butyldimethylsilyl)oxy)-ethyl trifluoromethanesulfo... | Fine Chemicals | CS-MM-12519 | 164162-36-1 | Enquire |
2-(3-(2-Chloroethyl)Ureido)-N,N-Dimethylethanesulfonamide | Fine Chemicals | CS-O-48887 | 91893-26-4 | In Stock |
2-(Perfluorohexyl)ethane-1-Sulfonic Acid | Fine Chemicals | CS-T-39064 | 27619-97-2 | In Stock |
2-(Perfluorohexyl)ethanethiol | Fine Chemicals | CS-O-55459 | 34451-26-8 | Enquire |
2-(Piperidin-4-yl)ethane-1-sulfonic acid | Fine Chemicals | CS-ZB-36666 | 4944-21-2 | Enquire |
2,8-Difluoro-5-(trifluoromethyl)dibenzothiophenium trifluoro... | Fine Chemicals | CS-O-54766 | 1961266-44-3 | Enquire |
2-Aminoethanesulfonamide hydrochloride | Fine Chemicals | CS-MM-42144 | 89756-60-5 | Enquire |
2-Bromo-1,1-Dimethoxyethane | Fine Chemicals | CS-M-57334 | 7252-83-7 | Enquire |
2-Bromoethanesulfonic Acid Sodium Salt | Fine Chemicals | CS-T-08279 | 4263-52-9 | Enquire |
2-Chloroethanesulfonyl chloride | Fine Chemicals | CS-M-25850 | 1622-32-8 | Enquire |
2-Iodoethaneamine | Fine Chemicals | CS-ED-41634 | 52689-15-3 | Enquire |
2-Isopropoxyethyl Methanesulfonate | Fine Chemicals | CS-ED-02283 | 235097-76-4 | Enquire |
2-Mercaptoethanesulfonic acid | Fine Chemicals | CS-O-53337 | 3375-50-6 | Enquire |
2-Methanesulfonylbenzene-1-thiol | Fine Chemicals | CS-O-54976 | 125106-55-0 | Enquire |
2-Methoxyethanesulfonamide | Fine Chemicals | CS-BX-02863 | 51517-04-5 | Enquire |
2-Perfluorohexylethanethiocyanate | Fine Chemicals | CS-O-55458 | 26650-09-9 | Enquire |
3,3-((Oxybis(ethane-2,1-diyl))bis(oxy))bis(propan-1-amine) | Fine Chemicals | CS-MM-12208 | 4246-51-9 | Enquire |
3-methanesulfinyl-2-methylpropanoic acid | Fine Chemicals | CS-ZB-00909 | 1248666-78-5 | Enquire |
4,4',4''-Methanetriyltribenzonitrile | Fine Chemicals | CS-T-58281 | 113402-31-6 | In Stock |
4,4,5,5,5-pentafluoropentyl methanesulfonate | Fine Chemicals | CS-ED-01290 | 252947-01-6 | Enquire |
Acetyl Methanesulfonate | Fine Chemicals | CS-T-93237 | 5539-53-7 | Enquire |
Ammonium trifluoromethanesulfonate | Fine Chemicals | CS-ZG-42873 | 38542-94-8 | Enquire |
Benzyl methanesulfonate | Fine Chemicals | CS-ZH-31218 | 55791-06-5 | Enquire |
Bis(4-acetylphenyl)methane | Fine Chemicals | CS-M-02920 | 790-82-9 | Enquire |
Bis(dicyclohexylphosphino)methane | Fine Chemicals | CS-DC-00446 | 137349-65-6 | Enquire |
Bis(phenylthio)methane | Fine Chemicals | CS-M-01884 | 3561-67-9 | Enquire |
Bromochloromethane | Fine Chemicals | CS-T-08058 | 74-97-5 | Enquire |
Bromodichloromethane | Fine Chemicals | CS-T-08145 | 75-27-4 | Enquire |
Bromoethane | Fine Chemicals | CS-T-08254 | 74-96-4 | Enquire |
Bromoiodomethane | Fine Chemicals | CS-T-68111 | 557-68-6 | Enquire |
Bromonitromethane | Fine Chemicals | CS-T-08707 | 563-70-2 | Enquire |
Bromotrichloromethane | Fine Chemicals | CS-DA-00031 | 75-62-7 | Enquire |
Chloro Ethane | Fine Chemicals | CS-O-01163 | 75-00-3 | Enquire |
Chlorofluoromethane | Fine Chemicals | CS-ZH-03517 | 593-70-4 | Enquire |
Chloronitromethane | Fine Chemicals | CS-T-12159 | 1794-84-9 | Enquire |
Chlorotriphenylmethane | Fine Chemicals | CS-T-62568 | 76-83-5 | In Stock |
Dibromodifluoromethane | Fine Chemicals | CS-ZG-17277 | 75-61-6 | Enquire |
Dibromomethane | Fine Chemicals | CS-T-17283 | 74-95-3 | Enquire |
Dichlorodifluoromethane | Fine Chemicals | CS-ZH-25514 | 75-71-8 | Enquire |
Dichloroiodomethane | Fine Chemicals | CS-T-52627 | 594-04-7 | In Stock |
Dichloromethane | Fine Chemicals | CS-RS-00124 | 750-09-2 | In Stock |
Dichloromethane anhydrous | Fine Chemicals | CS-O-13395 | 75-09-2 | In Stock |
Diethyl (difluoromethane)phosphonate | Fine Chemicals | CS-M-03551 | 1478-53-1 | Enquire |
Difluoroiodomethane | Fine Chemicals | CS-M-04777 | 1493-03-4 | Enquire |
Difluoromethane | Fine Chemicals | CS-M-01393 | 75-10-5 | Enquire |
Diiododifluoromethane | Fine Chemicals | CS-M-01900 | 1184-76-5 | Enquire |
Diiodomethane | Fine Chemicals | CS-BX-00470 | 75-11-6 | In Stock |
Dimethoxymethane | Fine Chemicals | CS-P-02423 | 109-87-5 | In Stock |
Diphenylmethane | Fine Chemicals | CS-DB-00060 | 101-81-5 | In Stock |
Diphenylmethane-4-carboxylic acid | Fine Chemicals | CS-MM-40092 | 620-86-0 | Enquire |
Ethane, 1,2-bis(2-bromoethoxy)- | Fine Chemicals | CS-ZG-12111 | 31255-10-4 | Enquire |
Ethanesulfonic acid | Fine Chemicals | CS-BX-02887 | 594-45-6 | Enquire |
Ethyl Methanesulfonate | Fine Chemicals | CS-P-01677 | 62-50-0 | In Stock |
Ethylsulfanylmethanethioamide | Fine Chemicals | CS-O-59786 | 625-61-6 | Enquire |
Fluorotribromomethane | Fine Chemicals | CS-M-03066 | 353-54-8 | Enquire |
Hexabromoethane | Fine Chemicals | CS-T-26034 | 594-73-0 | Enquire |
Hexachloroethane | Fine Chemicals | CS-T-79066 | 67-72-1 | In Stock |
Hexyl Methanesulfonate | Fine Chemicals | CS-T-78623 | 16156-50-6 | In Stock |
Isopropyl Methanesulfonate | Fine Chemicals | CS-AC-12246 | 926-06-7 | In Stock |
Isothiocyanatoethane | Fine Chemicals | CS-MM-52030 | 542-85-8 | In Stock |
Methane | Fine Chemicals | CS-ZH-32321 | 74-82-8 | Enquire |
Methane Sulphonic Anhydride pure | Fine Chemicals | CS-EP-00338 | 7143-01-3 | Enquire |
Methanesulfnoic acid n-butyl ester | Fine Chemicals | CS-O-11105 | 1912-32-9 | In Stock |
Methanesulfonamide | Fine Chemicals | CS-M-01876 | 3144-09-0 | In Stock |
Methyl methanesulfonylacetate | Fine Chemicals | CS-M-02870 | 62020-09-1 | Enquire |
Methyldisulfanylethane | Fine Chemicals | CS-ZJ-07552 | 20333-39-5 | Enquire |
methylsulfinylsulfanylmethane | Fine Chemicals | CS-ED-00682 | 13882-12-7 | Enquire |
N-(3-Amino-2,6-dimethylphenyl)methanesulfonamide | Fine Chemicals | CS-O-57294 | 86565-91-5 | Enquire |
N-(3-Piperidyl)methanesulfonamide | Fine Chemicals | CS-DJ-00401 | 944068-21-7 | Enquire |
N-(5-Amino-2,4-dimethylphenyl)methanesulfonamide | Fine Chemicals | CS-O-57292 | 1565558-95-3 | Enquire |
N,N-diethyl-N'-methylethane-1,2-diamine | Fine Chemicals | CS-N-05239 | 104-79-0 | Enquire |
N,N'-(azanediylbis(ethane-2,1-diyl))bis(4-methylbenzenesulfo... | Fine Chemicals | CS-O-40191 | 77429-97-1 | Enquire |
N,N-Dichlorourethane | Fine Chemicals | CS-EC-00088 | 13698-16-3 | Enquire |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
"1,1-Dibromo-2,2,2-trifluoroethane" | Building Blocks | CS-M-03390 | 354-30-3 | Enquire |
(+)-1,2-Bis((2S,5S)-2,5-diphenylphospholano)ethane | Building Blocks | CS-T-49295 | 824395-67-7 | In Stock |
(methanesulfonyloxy)methyl methanesulfonate | Building Blocks | CS-TA-49929 | 156-72-9 | Enquire |
(Perfluoro-n-octyl)ethane | Building Blocks | CS-M-02085 | 77117-48-7 | Enquire |
[1-(Trimethylammonium)methyl] Methanethiosulfonate Bromide | Building Blocks | CS-T-45612 | 386229-81-8 | Enquire |
[2-(Trimethylammonium)ethyl]methanethiosulfonate Bromide | Building Blocks | CS-T-45605 | 91774-25-3 | Enquire |
[6-(Trimethylammonium)hexyl] Methanethiosulfonate Bromide | Building Blocks | CS-T-45609 | 1041424-77-4 | Enquire |
[7-(Trimethylammonium)hepyl] Methanethiosulfonate Bromide | Building Blocks | CS-T-45608 | 1159174-26-1 | Enquire |
1,1-(1,2-Ethanediyl)bis[1-methyl-silane] | Building Blocks | CS-T-22217 | 4405-22-5 | Enquire |
1,1,1-Trichlorotrifluoroethane | Building Blocks | CS-T-45061 | 354-58-5 | In Stock |
1,1,1-Trifluoro-2-iodoethane | Building Blocks | CS-T-45263 | 353-83-3 | Enquire |
1,2-Bis(2,2-difluoroethoxy)ethane | Building Blocks | CS-O-52517 | 1691328-94-5 | Enquire |
1,2-Bis(2-chloroethoxy)ethane | Building Blocks | CS-O-46875 | 112-26-5 | Enquire |
1-Benzenesulfonate 1,2-Ethanediol | Building Blocks | CS-ZE-03563 | 249285-50-5 | In Stock |
1-Chloro-2-iodo-1,1,2-trifluoroethane | Building Blocks | CS-M-04694 | 354-26-7 | Enquire |
2,2-Dichloro-1,1,1-trifluoroethane | Building Blocks | CS-M-03702 | 306-83-2 | Enquire |
2-[Na-Benzoylbenzoicamido-N6-(6-biotinamidocaproyl)-L-lysiny... | Building Blocks | CS-T-48718 | 910036-44-1 | Enquire |
3-(Methanesulfonyl)phenylboronic acid | Building Blocks | CS-M-05122 | 373384-18-0 | Enquire |
3,3′-Diindolylmethane | Building Blocks | CS-O-57511 | 1968-05-4 | Enquire |
3-Methoxy-2-(trimethylsilyl)phenyl trifluoromethanesulfonate | Building Blocks | CS-O-44698 | 217813-03-1 | Enquire |
3-Pyridyl Trifluoromethanesulfonate | Building Blocks | CS-T-41190 | 107658-27-5 | Enquire |
4-(Methanesulfonyl)phenylboronic acid | Building Blocks | CS-M-01391 | 149104-88-1 | Enquire |
4-Azido-2,3,5,6-tetrafluorobenzamido-L-cysteine Methanethios... | Building Blocks | CS-T-04635 | 352000-06-7 | Enquire |
4-Guanidinobenzoic Acid Methanesulfonate | Building Blocks | CS-TB-61645 | 148720-07-4 | Enquire |
6-(Triethylammonium)hexyl Methanethiosulfonate Bromide | Building Blocks | CS-T-62300 | 386229-78-3 | Enquire |
Aluminum trifluoromethanesulfonate | Building Blocks | CS-EL-03118 | 74974-61-1 | In Stock |
Benzoic Acid, 4-(trans-4-pentylcyclohexyl)-, (1s)-1-phenyl-1... | Building Blocks | CS-O-48716 | 165660-09-3 | Enquire |
Benzoyl trifluoromethanesulphonate | Building Blocks | CS-CE-00078 | 36967-85-8 | Enquire |
Bis(trifluoromethanesulfonyl)methane | Building Blocks | CS-T-68107 | 428-76-2 | Enquire |
Bromotrifluoromethane | Building Blocks | CS-ED-41936 | 75-63-8 | Enquire |
Cyclobutylmethanethiol | Building Blocks | CS-O-44500 | 1352077-18-9 | Enquire |
Diphenylmethanethiol | Building Blocks | CS-T-96153 | 4237-48-3 | Enquire |
Ethane | Building Blocks | CS-O-59749 | 74-84-0 | Enquire |
Ethyl trifluoromethanesulfonate | Building Blocks | CS-M-01593 | 425-75-2 | Enquire |
Magnesium trifluoromethanesulfonimide | Building Blocks | CS-DV-03629 | 133395-16-1 | Enquire |
N′-(4-Methoxyphenyl)-N,N-dimethyl-1,2-ethanediamine | Building Blocks | CS-O-56911 | 92058-52-1 | Enquire |
N1-(2-(2-(2-methoxyethoxy)ethoxy)ethyl)-N1-methylethane-1,2-... | Building Blocks | CS-O-46869 | 1566528-95-7 | Enquire |
N1-(2-chloroethyl)ethane-1,2-diamine | Building Blocks | CS-O-44011 | 92463-21-3 | Enquire |
N1-decyl-N1-methylethane-1,2-diamine | Building Blocks | CS-O-46868 | 744165-26-2 | Enquire |
N-a-Tosyl-L-phenylalanylchloromethane | Building Blocks | CS-T-62170 | 402-71-1 | Enquire |
N-Phenylbis(trifluoromethanesulfonamide) | Building Blocks | CS-T-39439 | 37595-74-7 | In Stock |
N-α-Tosyl-L-lysylchloromethane hydrochloride | Building Blocks | CS-O-53287 | 4272-74-6 | Enquire |
propan-2-yl ethane-1-sulfonate | Building Blocks | CS-TA-54341 | 14245-62-6 | In Stock |
S-Benzyl-N-boc-ethanethiolamine | Building Blocks | CS-T-05485 | 873330-01-9 | Enquire |
Silver Trifluoromethanesulfonate | Building Blocks | CS-M-01812 | 2923-28-6 | Enquire |
Sodium trifluoromethanesulfinate | Building Blocks | CS-M-04856 | 2926-29-6 | Enquire |
Sulfonmethane | Building Blocks | CS-O-48237 | 115-24-2 | Enquire |
Tributylmethylammonium bis(trifluoromethanesulfonyl)imide | Building Blocks | CS-DA-00080 | 405514-94-5 | Enquire |
Trifluoro methane sulfonic acid tert amyl ester | Building Blocks | CS-O-46745 | Not Available | Enquire |
Trifluoromethanesulfonamide | Building Blocks | CS-M-01916 | 421-85-2 | Enquire |
Trifluoromethanesulfonic Acid | Building Blocks | CS-O-30811 | 1493-13-6 | In Stock |
Trifluoromethanesulfonic Anhydride | Building Blocks | CS-T-45266 | 358-23-6 | In Stock |
COMPOUND | CATEGORY | CAT. No. | CAS. No. | STOCK STATUS |
---|---|---|---|---|
1,1,1,2-Tetrachloroethane | Pesticide Standards | CS-T-87311 | 630-20-6 | In Stock |
Chlorodiphenylmethane | Pesticide Standards | CS-T-72923 | 90-99-3 | In Stock |
Dibenzoylmethane | Pesticide Standards | CS-T-88560 | 120-46-7 | Enquire |
Dibromoethane | Pesticide Standards | CS-T-17231 | 106-93-4 | In Stock |
Ethanethiol | Pesticide Standards | CS-T-22021 | 75-08-1 | In Stock |
Iodoethane | Pesticide Standards | CS-T-29442 | 75-03-6 | In Stock |
Methyl methanesulfonate (GC Grade) | Pesticide Standards | CS-RS-00118 | 66-27-3 | Enquire |